About [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate
[2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate (PubChem CID 123984653) has the molecular formula C15H26O6S2
and a molecular weight of 366.50 g/mol. Its IUPAC name is [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate |
| PubChem CID | 123984653 |
| Molecular Formula | C15H26O6S2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate |
| SMILES | CSCCC1OC(OC(=O)CCC(O)SC)(C(C)(C)C)OC1=O |
| InChI | InChI=1S/C15H26O6S2/c1-14(2,3)15(20-11(16)6-7-12(17)23-5)19-10(8-9-22-4)13(18)21-15/h10,12,17H,6-9H2,1-5H3 |
| InChIKey | SVSZQVPVKWNEQZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate?
The IUPAC name of [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate (CID 123984653) is [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate.
What is the SMILES notation for [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate?
The canonical SMILES for [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate is CSCCC1OC(OC(=O)CCC(O)SC)(C(C)(C)C)OC1=O.
What is the InChIKey of [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate?
The InChIKey is SVSZQVPVKWNEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O6S2/c1-14(2,3)15(20-11(16)6-7-12(17)23-5)19-10(8-9-22-4)13(18)21-15/h10,12,17H,6-9H2,1-5H3.
What are the key properties of [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate?
[2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate has a molecular weight of 366.50 g/mol, XLogP of 2.39, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-tert-butyl-4-(2-methylsulfanylethyl)-5-oxo-1,3-dioxolan-2-yl] 4-hydroxy-4-methylsulfanylbutanoate is sourced from PubChem (CID 123984653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).