C16H21ClN4O3S — CID 123984863
2-(4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-6-yl)-N-(3-methylsulfonylpropyl)acetamide (PubChem CID 123984863) has the molecular formula C16H21ClN4O3S and a molecular weight of 384.89 g/mol. Its IUPAC name is 2-(4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-6-yl)-N-(3-methylsulfonylpropyl)acetamide.
| Compound Name | 2-(4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-6-yl)-N-(3-methylsulfonylpropyl)acetamide |
|---|---|
| PubChem CID | 123984863 |
| Molecular Formula | C16H21ClN4O3S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-(4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-6-yl)-N-(3-methylsulfonylpropyl)acetamide |
| SMILES | CS(=O)(=O)CCCNC(=O)CC1CCc2[nH]c3ncnc(Cl)c3c2C1 |
| InChI | InChI=1S/C16H21ClN4O3S/c1-25(23,24)6-2-5-18-13(22)8-10-3-4-12-11(7-10)14-15(17)19-9-20-16(14)21-12/h9-10H,2-8H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | UQCMNJZWTUBEMI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|