About 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol
2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol (PubChem CID 123985232) has the molecular formula C13H11ClFNO
and a molecular weight of 251.69 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol |
| PubChem CID | 123985232 |
| Molecular Formula | C13H11ClFNO |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol |
| SMILES | Cc1cc(O)c(-c2ccc(F)c(Cl)c2)nc1C |
| InChI | InChI=1S/C13H11ClFNO/c1-7-5-12(17)13(16-8(7)2)9-3-4-11(15)10(14)6-9/h3-6,17H,1-2H3 |
| InChIKey | KCHCNXNQLLXHLD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol?
The IUPAC name of 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol (CID 123985232) is 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol.
What is the SMILES notation for 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol?
The canonical SMILES for 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol is Cc1cc(O)c(-c2ccc(F)c(Cl)c2)nc1C.
What is the InChIKey of 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol?
The InChIKey is KCHCNXNQLLXHLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClFNO/c1-7-5-12(17)13(16-8(7)2)9-3-4-11(15)10(14)6-9/h3-6,17H,1-2H3.
What are the key properties of 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol?
2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol has a molecular weight of 251.69 g/mol, XLogP of 3.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4-fluorophenyl)-5,6-dimethylpyridin-3-ol is sourced from PubChem (CID 123985232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).