C9H21NSi — CID 123985315
N,N,2-triethylsiletan-2-amine (PubChem CID 123985315) has the molecular formula C9H21NSi and a molecular weight of 171.36 g/mol. Its IUPAC name is N,N,2-triethylsiletan-2-amine.
| Compound Name | N,N,2-triethylsiletan-2-amine |
|---|---|
| PubChem CID | 123985315 |
| Molecular Formula | C9H21NSi |
| Molecular Weight | 171.36 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N,N,2-triethylsiletan-2-amine |
| SMILES | CCN(CC)C1(CC)CC[SiH2]1 |
| InChI | InChI=1S/C9H21NSi/c1-4-9(7-8-11-9)10(5-2)6-3/h4-8,11H2,1-3H3 |
| InChIKey | LVDRLTZCAVJWJH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|