About 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene
1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene (PubChem CID 123985627) has the molecular formula C7H11NS2
and a molecular weight of 173.31 g/mol. Its IUPAC name is 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene.
Molecular Properties
| Compound Name | 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene |
| PubChem CID | 123985627 |
| Molecular Formula | C7H11NS2 |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene |
| SMILES | CSS1(C)=CC=CC=NC=1 |
| InChI | InChI=1S/C7H11NS2/c1-9-10(2)6-4-3-5-8-7-10/h3-7H,1-2H3 |
| InChIKey | TZIVYGCGVDARKW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene?
The IUPAC name of 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene (CID 123985627) is 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene.
What is the SMILES notation for 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene?
The canonical SMILES for 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene is CSS1(C)=CC=CC=NC=1.
What is the InChIKey of 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene?
The InChIKey is TZIVYGCGVDARKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS2/c1-9-10(2)6-4-3-5-8-7-10/h3-7H,1-2H3.
What are the key properties of 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene?
1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene has a molecular weight of 173.31 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-methylsulfanyl-1λ6-thia-3-azacyclohepta-1,3,5,7-tetraene is sourced from PubChem (CID 123985627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).