C15H16F2O — CID 123985709
(4aS,9aS)-6,7-difluoro-4,4-dimethyl-2,3,4a,9a-tetrahydro-1H-fluoren-9-one (PubChem CID 123985709) has the molecular formula C15H16F2O and a molecular weight of 250.29 g/mol. Its IUPAC name is (4aS,9aS)-6,7-difluoro-4,4-dimethyl-2,3,4a,9a-tetrahydro-1H-fluoren-9-one.
| Compound Name | (4aS,9aS)-6,7-difluoro-4,4-dimethyl-2,3,4a,9a-tetrahydro-1H-fluoren-9-one |
|---|---|
| PubChem CID | 123985709 |
| Molecular Formula | C15H16F2O |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (4aS,9aS)-6,7-difluoro-4,4-dimethyl-2,3,4a,9a-tetrahydro-1H-fluoren-9-one |
| SMILES | CC1(C)CCC[C@@H]2C(=O)c3cc(F)c(F)cc3[C@@H]21 |
| InChI | InChI=1S/C15H16F2O/c1-15(2)5-3-4-8-13(15)9-6-11(16)12(17)7-10(9)14(8)18/h6-8,13H,3-5H2,1-2H3/t8-,13+/m0/s1 |
| InChIKey | DFNJDKXYPCNUPM-ISVAXAHUSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |