C16H30N3+ — CID 123986101
3-(1-methyl-3-aza-1-azoniabicyclo[2.2.2]octan-5-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 123986101) has the molecular formula C16H30N3+ and a molecular weight of 264.44 g/mol. Its IUPAC name is 3-(1-methyl-3-aza-1-azoniabicyclo[2.2.2]octan-5-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 3-(1-methyl-3-aza-1-azoniabicyclo[2.2.2]octan-5-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 123986101 |
| Molecular Formula | C16H30N3+ |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | 3-(1-methyl-3-aza-1-azoniabicyclo[2.2.2]octan-5-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | C[N+]12CCC(NC1)C(C1CCC3CCCCN3C1)C2 |
| InChI | InChI=1S/C16H30N3/c1-19-9-7-16(17-12-19)15(11-19)13-5-6-14-4-2-3-8-18(14)10-13/h13-17H,2-12H2,1H3/q+1 |
| InChIKey | DEFSGVXUXOWMTN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|