C12H22Si — CID 123986229
dimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123986229) has the molecular formula C12H22Si and a molecular weight of 194.39 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | dimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123986229 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | dimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)(C)C([SiH](C)C)=C1C |
| InChI | InChI=1S/C12H22Si/c1-8-9(2)11(13(6)7)12(4,5)10(8)3/h13H,1-7H3 |
| InChIKey | WPRIWWXEBFUCOR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|