About 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine
1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine (PubChem CID 123986318) has the molecular formula C6H6F5N
and a molecular weight of 187.11 g/mol. Its IUPAC name is 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine.
Molecular Properties
| Compound Name | 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine |
| PubChem CID | 123986318 |
| Molecular Formula | C6H6F5N |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine |
| SMILES | C=C(F)F.[H]/N=C(\C)C(F)=C(F)F |
| InChI | InChI=1S/C4H4F3N.C2H2F2/c1-2(8)3(5)4(6)7;1-2(3)4/h8H,1H3;1H2/b8-2+; |
| InChIKey | AIWVLPHNDNXTAN-VOKCZWNHSA-N |
| XLogP | 3.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine?
The IUPAC name of 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine (CID 123986318) is 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine.
What is the SMILES notation for 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine?
The canonical SMILES for 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine is C=C(F)F.[H]/N=C(\C)C(F)=C(F)F.
What is the InChIKey of 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine?
The InChIKey is AIWVLPHNDNXTAN-VOKCZWNHSA-N. The full InChI is InChI=1S/C4H4F3N.C2H2F2/c1-2(8)3(5)4(6)7;1-2(3)4/h8H,1H3;1H2/b8-2+;.
What are the key properties of 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine?
1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine has a molecular weight of 187.11 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethene;3,4,4-trifluorobut-3-en-2-imine is sourced from PubChem (CID 123986318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).