About N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide
N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide (PubChem CID 123986457) has the molecular formula C11H15FN2
and a molecular weight of 194.25 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide |
| PubChem CID | 123986457 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide |
| SMILES | C/N=C/N(C)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2/c1-9(14(3)8-13-2)10-4-6-11(12)7-5-10/h4-9H,1-3H3/b13-8+ |
| InChIKey | ZDAUAYIKPWPNPA-MDWZMJQESA-N |
| XLogP | 2.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide?
The IUPAC name of N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide (CID 123986457) is N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide.
What is the SMILES notation for N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide?
The canonical SMILES for N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide is C/N=C/N(C)C(C)c1ccc(F)cc1.
What is the InChIKey of N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide?
The InChIKey is ZDAUAYIKPWPNPA-MDWZMJQESA-N. The full InChI is InChI=1S/C11H15FN2/c1-9(14(3)8-13-2)10-4-6-11(12)7-5-10/h4-9H,1-3H3/b13-8+.
What are the key properties of N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide?
N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide has a molecular weight of 194.25 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-fluorophenyl)ethyl]-N,N'-dimethylmethanimidamide is sourced from PubChem (CID 123986457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).