C27H34F3N3O4 — CID 123986550
5-[2-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide (PubChem CID 123986550) has the molecular formula C27H34F3N3O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is 5-[2-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide.
| Compound Name | 5-[2-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 123986550 |
| Molecular Formula | C27H34F3N3O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 5-[2-[2-[5-ethyl-2-(2,2,2-trifluoroethoxy)phenoxy]ethylamino]propyl]-1-(3-hydroxypropyl)indole-7-carboxamide |
| SMILES | CCc1ccc(OCC(F)(F)F)c(OCCNC(C)Cc2cc(C(N)=O)c3c(ccn3CCCO)c2)c1 |
| InChI | InChI=1S/C27H34F3N3O4/c1-3-19-5-6-23(37-17-27(28,29)30)24(16-19)36-12-8-32-18(2)13-20-14-21-7-10-33(9-4-11-34)25(21)22(15-20)26(31)35/h5-7,10,14-16,18,32,34H,3-4,8-9,11-13,17H2,1-2H3,(H2,31,35) |
| InChIKey | PRXOMQQBQYMDMK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|