C15H36N4Si — CID 123986851
1-N,1-N',2-N-tripropyl-2-N'-silylcyclohexane-1,1,2,2-tetramine (PubChem CID 123986851) has the molecular formula C15H36N4Si and a molecular weight of 300.57 g/mol. Its IUPAC name is 1-N,1-N',2-N-tripropyl-2-N'-silylcyclohexane-1,1,2,2-tetramine.
| Compound Name | 1-N,1-N',2-N-tripropyl-2-N'-silylcyclohexane-1,1,2,2-tetramine |
|---|---|
| PubChem CID | 123986851 |
| Molecular Formula | C15H36N4Si |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 1-N,1-N',2-N-tripropyl-2-N'-silylcyclohexane-1,1,2,2-tetramine |
| SMILES | CCCNC1(N[SiH3])CCCCC1(NCCC)NCCC |
| InChI | InChI=1S/C15H36N4Si/c1-4-11-16-14(17-12-5-2)9-7-8-10-15(14,19-20)18-13-6-3/h16-19H,4-13H2,1-3,20H3 |
| InChIKey | CDKFBJQOTIVNFN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|