C20H34N2O4S — CID 123986973
1-(2-methylbutanoylamino)-N-(1-methylcyclopropyl)sulfonyl-2-(5-methylhex-1-enyl)cyclopropane-1-carboxamide (PubChem CID 123986973) has the molecular formula C20H34N2O4S and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-(2-methylbutanoylamino)-N-(1-methylcyclopropyl)sulfonyl-2-(5-methylhex-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(2-methylbutanoylamino)-N-(1-methylcyclopropyl)sulfonyl-2-(5-methylhex-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123986973 |
| Molecular Formula | C20H34N2O4S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-(2-methylbutanoylamino)-N-(1-methylcyclopropyl)sulfonyl-2-(5-methylhex-1-enyl)cyclopropane-1-carboxamide |
| SMILES | CCC(C)C(=O)NC1(C(=O)NS(=O)(=O)C2(C)CC2)CC1C=CCCC(C)C |
| InChI | InChI=1S/C20H34N2O4S/c1-6-15(4)17(23)21-20(13-16(20)10-8-7-9-14(2)3)18(24)22-27(25,26)19(5)11-12-19/h8,10,14-16H,6-7,9,11-13H2,1-5H3,(H,21,23)(H,22,24) |
| InChIKey | FVQYDIIEYKMKKC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|