About (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate
(3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate (PubChem CID 123987526) has the molecular formula C13H23NO4
and a molecular weight of 257.33 g/mol. Its IUPAC name is (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate |
| PubChem CID | 123987526 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C(O)C2CC(O)CC1N2C |
| InChI | InChI=1S/C13H23NO4/c1-4-7(2)13(17)18-12-10-6-8(15)5-9(11(12)16)14(10)3/h7-12,15-16H,4-6H2,1-3H3 |
| InChIKey | DSOAOEFDXTZFDT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate?
The IUPAC name of (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate (CID 123987526) is (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate.
What is the SMILES notation for (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate?
The canonical SMILES for (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate is CCC(C)C(=O)OC1C(O)C2CC(O)CC1N2C.
What is the InChIKey of (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate?
The InChIKey is DSOAOEFDXTZFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4/c1-4-7(2)13(17)18-12-10-6-8(15)5-9(11(12)16)14(10)3/h7-12,15-16H,4-6H2,1-3H3.
What are the key properties of (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate?
(3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate has a molecular weight of 257.33 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-6-yl) 2-methylbutanoate is sourced from PubChem (CID 123987526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).