C28H24F5N5O2 — CID 123987820
N-cyclopropyl-4-[6-(2,3-difluorobenzoyl)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-N,2-dimethylbenzamide (PubChem CID 123987820) has the molecular formula C28H24F5N5O2 and a molecular weight of 557.52 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-(2,3-difluorobenzoyl)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-N,2-dimethylbenzamide.
| Compound Name | N-cyclopropyl-4-[6-(2,3-difluorobenzoyl)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 123987820 |
| Molecular Formula | C28H24F5N5O2 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | N-cyclopropyl-4-[6-(2,3-difluorobenzoyl)-8-(3,3,3-trifluoropropylamino)imidazo[1,2-b]pyridazin-3-yl]-N,2-dimethylbenzamide |
| SMILES | Cc1cc(-c2cnc3c(NCCC(F)(F)F)cc(C(=O)c4cccc(F)c4F)nn23)ccc1C(=O)N(C)C1CC1 |
| InChI | InChI=1S/C28H24F5N5O2/c1-15-12-16(6-9-18(15)27(40)37(2)17-7-8-17)23-14-35-26-22(34-11-10-28(31,32)33)13-21(36-38(23)26)25(39)19-4-3-5-20(29)24(19)30/h3-6,9,12-14,17,34H,7-8,10-11H2,1-2H3 |
| InChIKey | NLCSHYGMCBQCPP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |