C17H28F3NO3 — CID 123987855
(9S,10S,11R)-9-methoxy-11,13-dimethyl-2-(trifluoromethyl)-1-azacyclotetradeca-7,12-diene-2,10-diol (PubChem CID 123987855) has the molecular formula C17H28F3NO3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (9S,10S,11R)-9-methoxy-11,13-dimethyl-2-(trifluoromethyl)-1-azacyclotetradeca-7,12-diene-2,10-diol.
| Compound Name | (9S,10S,11R)-9-methoxy-11,13-dimethyl-2-(trifluoromethyl)-1-azacyclotetradeca-7,12-diene-2,10-diol |
|---|---|
| PubChem CID | 123987855 |
| Molecular Formula | C17H28F3NO3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (9S,10S,11R)-9-methoxy-11,13-dimethyl-2-(trifluoromethyl)-1-azacyclotetradeca-7,12-diene-2,10-diol |
| SMILES | CO[C@H]1C=CCCCCC(O)(C(F)(F)F)NCC(C)=C[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H28F3NO3/c1-12-10-13(2)15(22)14(24-3)8-6-4-5-7-9-16(23,21-11-12)17(18,19)20/h6,8,10,13-15,21-23H,4-5,7,9,11H2,1-3H3/t13-,14+,15+,16?/m1/s1 |
| InChIKey | MWNSJOIFEKLVNH-WTPYQEHOSA-N |
| XLogP | 2.92 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|