C27H29N3O3 — CID 123988198
13-cyclohexyl-14-hydroxy-10-(4-methoxyphenyl)-4-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaen-12-one (PubChem CID 123988198) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 13-cyclohexyl-14-hydroxy-10-(4-methoxyphenyl)-4-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaen-12-one.
| Compound Name | 13-cyclohexyl-14-hydroxy-10-(4-methoxyphenyl)-4-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaen-12-one |
|---|---|
| PubChem CID | 123988198 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 13-cyclohexyl-14-hydroxy-10-(4-methoxyphenyl)-4-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,14-pentaen-12-one |
| SMILES | COc1ccc(C2c3[nH]c4ccc(C)cc4c3Cc3c(O)n(C4CCCCC4)c(=O)n32)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-16-8-13-22-20(14-16)21-15-23-26(31)29(18-6-4-3-5-7-18)27(32)30(23)25(24(21)28-22)17-9-11-19(33-2)12-10-17/h8-14,18,25,28,31H,3-7,15H2,1-2H3 |
| InChIKey | PQBIZZWAHNDOFM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|