C6H12OS — CID 123988402
(2S)-3,4-dimethylthiolan-2-ol (PubChem CID 123988402) has the molecular formula C6H12OS and a molecular weight of 132.23 g/mol. Its IUPAC name is (2S)-3,4-dimethylthiolan-2-ol.
| Compound Name | (2S)-3,4-dimethylthiolan-2-ol |
|---|---|
| PubChem CID | 123988402 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | (2S)-3,4-dimethylthiolan-2-ol |
| SMILES | CC1CS[C@H](O)C1C |
| InChI | InChI=1S/C6H12OS/c1-4-3-8-6(7)5(4)2/h4-7H,3H2,1-2H3/t4?,5?,6-/m0/s1 |
| InChIKey | CREOYOGISFJKNO-WRVKLSGPSA-N |
| XLogP | 1.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |