C22H31N3O — CID 123988434
N-[6-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2,4-dimethyl-3-pyridinyl]-3,3-dimethylbutanamide (PubChem CID 123988434) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is N-[6-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2,4-dimethyl-3-pyridinyl]-3,3-dimethylbutanamide.
| Compound Name | N-[6-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2,4-dimethyl-3-pyridinyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123988434 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | N-[6-(4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-2,4-dimethyl-3-pyridinyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(N2CC3C4C=CC(C4)C3C2)nc(C)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C22H31N3O/c1-13-8-19(23-14(2)21(13)24-20(26)10-22(3,4)5)25-11-17-15-6-7-16(9-15)18(17)12-25/h6-8,15-18H,9-12H2,1-5H3,(H,24,26) |
| InChIKey | DLDBUPFPHWLWRG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|