About 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine
5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine (PubChem CID 123989112) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine.
Molecular Properties
| Compound Name | 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine |
| PubChem CID | 123989112 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine |
| SMILES | CC1=COCCN1C(C)C |
| InChI | InChI=1S/C8H15NO/c1-7(2)9-4-5-10-6-8(9)3/h6-7H,4-5H2,1-3H3 |
| InChIKey | KQXCQJJLRAYJGB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine?
The IUPAC name of 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine (CID 123989112) is 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine.
What is the SMILES notation for 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine?
The canonical SMILES for 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine is CC1=COCCN1C(C)C.
What is the InChIKey of 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine?
The InChIKey is KQXCQJJLRAYJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-7(2)9-4-5-10-6-8(9)3/h6-7H,4-5H2,1-3H3.
What are the key properties of 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine?
5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine has a molecular weight of 141.21 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-propan-2-yl-2,3-dihydro-1,4-oxazine is sourced from PubChem (CID 123989112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).