C9H7N3OS — CID 123989227
2,4-dihydro-1H-pyrazolo[4,3-c][1,2]benzothiazin-3-one (PubChem CID 123989227) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is 2,4-dihydro-1H-pyrazolo[4,3-c][1,2]benzothiazin-3-one.
| Compound Name | 2,4-dihydro-1H-pyrazolo[4,3-c][1,2]benzothiazin-3-one |
|---|---|
| PubChem CID | 123989227 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 2,4-dihydro-1H-pyrazolo[4,3-c][1,2]benzothiazin-3-one |
| SMILES | O=c1[nH][nH]c2c1NSc1ccccc1-2 |
| InChI | InChI=1S/C9H7N3OS/c13-9-8-7(10-11-9)5-3-1-2-4-6(5)14-12-8/h1-4,12H,(H2,10,11,13) |
| InChIKey | ADAHBCBUBQEGKZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|