About 2-amino-6-fluoro-N'-phenylbenzohydrazide
2-amino-6-fluoro-N'-phenylbenzohydrazide (PubChem CID 123989281) has the molecular formula C13H12FN3O
and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-amino-6-fluoro-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | 2-amino-6-fluoro-N'-phenylbenzohydrazide |
| PubChem CID | 123989281 |
| Molecular Formula | C13H12FN3O |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-amino-6-fluoro-N'-phenylbenzohydrazide |
| SMILES | Nc1cccc(F)c1C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C13H12FN3O/c14-10-7-4-8-11(15)12(10)13(18)17-16-9-5-2-1-3-6-9/h1-8,16H,15H2,(H,17,18) |
| InChIKey | VXZSQHKEYCPBND-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-fluoro-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-fluoro-N'-phenylbenzohydrazide?
The IUPAC name of 2-amino-6-fluoro-N'-phenylbenzohydrazide (CID 123989281) is 2-amino-6-fluoro-N'-phenylbenzohydrazide.
What is the SMILES notation for 2-amino-6-fluoro-N'-phenylbenzohydrazide?
The canonical SMILES for 2-amino-6-fluoro-N'-phenylbenzohydrazide is Nc1cccc(F)c1C(=O)NNc1ccccc1.
What is the InChIKey of 2-amino-6-fluoro-N'-phenylbenzohydrazide?
The InChIKey is VXZSQHKEYCPBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O/c14-10-7-4-8-11(15)12(10)13(18)17-16-9-5-2-1-3-6-9/h1-8,16H,15H2,(H,17,18).
What are the key properties of 2-amino-6-fluoro-N'-phenylbenzohydrazide?
2-amino-6-fluoro-N'-phenylbenzohydrazide has a molecular weight of 245.26 g/mol, XLogP of 2.16, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-fluoro-N'-phenylbenzohydrazide is sourced from PubChem (CID 123989281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).