About 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate
1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate (PubChem CID 123989393) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate |
| PubChem CID | 123989393 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate |
| SMILES | CC(OC(=O)N(C)C)C1=CCC=CCC1 |
| InChI | InChI=1S/C12H19NO2/c1-10(15-12(14)13(2)3)11-8-6-4-5-7-9-11/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | XBSOANGPCDIASD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate?
The IUPAC name of 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate (CID 123989393) is 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate.
What is the SMILES notation for 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate?
The canonical SMILES for 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate is CC(OC(=O)N(C)C)C1=CCC=CCC1.
What is the InChIKey of 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate?
The InChIKey is XBSOANGPCDIASD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-10(15-12(14)13(2)3)11-8-6-4-5-7-9-11/h4-5,8,10H,6-7,9H2,1-3H3.
What are the key properties of 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate?
1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate has a molecular weight of 209.29 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,4-dien-1-ylethyl N,N-dimethylcarbamate is sourced from PubChem (CID 123989393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).