2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid

C12H20O5 — CID 123989562

IUPAC2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)C1CC(C=O)OC(C)(C)O1
InChIInChI=1S/C12H20O5/c1-7(2)10(11(14)15)9-5-8(6-13)16-12(3,4)17-9/h6-10H,5H2,1-4H3,(H,14,15)
InChIKeyXQWUUESPWDUSFH-UHFFFAOYSA-N
MW244.29 g/mol
LogP1.45
Rot. Bonds4

About 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid

2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid (PubChem CID 123989562) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid
PubChem CID123989562
Molecular FormulaC12H20O5
Molecular Weight244.29 g/mol
Exact Mass244.13
IUPAC Name2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid
SMILESCC(C)C(C(=O)O)C1CC(C=O)OC(C)(C)O1
InChIInChI=1S/C12H20O5/c1-7(2)10(11(14)15)9-5-8(6-13)16-12(3,4)17-9/h6-10H,5H2,1-4H3,(H,14,15)
InChIKeyXQWUUESPWDUSFH-UHFFFAOYSA-N
XLogP1.45
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid?
The IUPAC name of 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid (CID 123989562) is 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid?
The canonical SMILES for 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid is CC(C)C(C(=O)O)C1CC(C=O)OC(C)(C)O1.
What is the InChIKey of 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid?
The InChIKey is XQWUUESPWDUSFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5/c1-7(2)10(11(14)15)9-5-8(6-13)16-12(3,4)17-9/h6-10H,5H2,1-4H3,(H,14,15).
What are the key properties of 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid?
2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid has a molecular weight of 244.29 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)-3-methylbutanoic acid is sourced from PubChem (CID 123989562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).