C12H18O2S — CID 123989601
1,5-dimethyl-2-methylsulfonyl-4-propan-2-ylbenzene (PubChem CID 123989601) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 1,5-dimethyl-2-methylsulfonyl-4-propan-2-ylbenzene.
| Compound Name | 1,5-dimethyl-2-methylsulfonyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 123989601 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1,5-dimethyl-2-methylsulfonyl-4-propan-2-ylbenzene |
| SMILES | Cc1cc(C)c(S(C)(=O)=O)cc1C(C)C |
| InChI | InChI=1S/C12H18O2S/c1-8(2)11-7-12(15(5,13)14)10(4)6-9(11)3/h6-8H,1-5H3 |
| InChIKey | LPONOLDBSHEQCC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |