C18H28N4O10 — CID 123990524
4-[[2-[(2-acetamido-4-formyl-5-hydroxypentanoyl)amino]-4-carboxybutanoyl]amino]-5-amino-5-oxopentanoic acid (PubChem CID 123990524) has the molecular formula C18H28N4O10 and a molecular weight of 460.44 g/mol. Its IUPAC name is 4-[[2-[(2-acetamido-4-formyl-5-hydroxypentanoyl)amino]-4-carboxybutanoyl]amino]-5-amino-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-acetamido-4-formyl-5-hydroxypentanoyl)amino]-4-carboxybutanoyl]amino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123990524 |
| Molecular Formula | C18H28N4O10 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-[[2-[(2-acetamido-4-formyl-5-hydroxypentanoyl)amino]-4-carboxybutanoyl]amino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)NC(CC(C=O)CO)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C18H28N4O10/c1-9(25)20-13(6-10(7-23)8-24)18(32)22-12(3-5-15(28)29)17(31)21-11(16(19)30)2-4-14(26)27/h7,10-13,24H,2-6,8H2,1H3,(H2,19,30)(H,20,25)(H,21,31)(H,22,32)(H,26,27)(H,28,29) |
| InChIKey | VUKINUGCFPWFGD-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 242.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|