C18H28N2 — CID 123990770
2-(5-tert-butyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydroindol-2-ylidene)-N-methylethanimine (PubChem CID 123990770) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-(5-tert-butyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydroindol-2-ylidene)-N-methylethanimine.
| Compound Name | 2-(5-tert-butyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydroindol-2-ylidene)-N-methylethanimine |
|---|---|
| PubChem CID | 123990770 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-(5-tert-butyl-3-ethylidene-1-methyl-4,5,6,7-tetrahydroindol-2-ylidene)-N-methylethanimine |
| SMILES | CC=c1c2c(n(C)c1=C/C=N/C)CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C18H28N2/c1-7-14-15-12-13(18(2,3)4)8-9-16(15)20(6)17(14)10-11-19-5/h7,10-11,13H,8-9,12H2,1-6H3/b14-7?,17-10?,19-11+ |
| InChIKey | FOHZWAHROQCDIJ-BFQLTMIPSA-N |
| XLogP | 2.46 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|