C15H26F3N5O2 — CID 123990837
tert-butyl N-[1-[C-(2-aminoethanimidoyl)-N-methylcarbonimidoyl]-5-(trifluoromethyl)piperidin-3-yl]carbamate (PubChem CID 123990837) has the molecular formula C15H26F3N5O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is tert-butyl N-[1-[C-(2-aminoethanimidoyl)-N-methylcarbonimidoyl]-5-(trifluoromethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[C-(2-aminoethanimidoyl)-N-methylcarbonimidoyl]-5-(trifluoromethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123990837 |
| Molecular Formula | C15H26F3N5O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl N-[1-[C-(2-aminoethanimidoyl)-N-methylcarbonimidoyl]-5-(trifluoromethyl)piperidin-3-yl]carbamate |
| SMILES | [H]/N=C(CN)/C(=N\C)N1CC(NC(=O)OC(C)(C)C)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H26F3N5O2/c1-14(2,3)25-13(24)22-10-5-9(15(16,17)18)7-23(8-10)12(21-4)11(20)6-19/h9-10,20H,5-8,19H2,1-4H3,(H,22,24)/b20-11+,21-12+ |
| InChIKey | OAJVNSWBWYYYGM-HGEIODPWSA-N |
| XLogP | 1.77 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|