C33H54OS2 — CID 123991450
3,7,11-trimethyl-12-[2-(2,6,10-trimethylundeca-1,5,9-trienyl)-1,3-dithian-2-yl]dodeca-2,6,10-trien-1-ol (PubChem CID 123991450) has the molecular formula C33H54OS2 and a molecular weight of 530.93 g/mol. Its IUPAC name is 3,7,11-trimethyl-12-[2-(2,6,10-trimethylundeca-1,5,9-trienyl)-1,3-dithian-2-yl]dodeca-2,6,10-trien-1-ol.
| Compound Name | 3,7,11-trimethyl-12-[2-(2,6,10-trimethylundeca-1,5,9-trienyl)-1,3-dithian-2-yl]dodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 123991450 |
| Molecular Formula | C33H54OS2 |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 3,7,11-trimethyl-12-[2-(2,6,10-trimethylundeca-1,5,9-trienyl)-1,3-dithian-2-yl]dodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC1(CC(C)=CCCC(C)=CCCC(C)=CCO)SCCCS1 |
| InChI | InChI=1S/C33H54OS2/c1-27(2)13-8-14-28(3)16-10-19-31(6)25-33(35-23-12-24-36-33)26-32(7)20-11-17-29(4)15-9-18-30(5)21-22-34/h13,15-16,20-21,25,34H,8-12,14,17-19,22-24,26H2,1-7H3 |
| InChIKey | ZMETWIJCGOHEHH-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|