C21H32O6 — CID 123991735
1-(16-hydroxy-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-4-yl)ethane-1,2-diol (PubChem CID 123991735) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-(16-hydroxy-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-4-yl)ethane-1,2-diol.
| Compound Name | 1-(16-hydroxy-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-4-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 123991735 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 1-(16-hydroxy-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-4-yl)ethane-1,2-diol |
| SMILES | CC1(C)C2=CCCC1(O)CC1C3COC3CCC1C1OC(C(O)CO)OC21 |
| InChI | InChI=1S/C21H32O6/c1-20(2)14-4-3-7-21(20,24)8-12-11(5-6-16-13(12)10-25-16)17-18(14)27-19(26-17)15(23)9-22/h4,11-13,15-19,22-24H,3,5-10H2,1-2H3 |
| InChIKey | PWWFHNZDPSGCCS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|