C17H26N4S — CID 123991908
7-ethyl-2-imino-3-methyl-6-[2-(5-methylthiophen-2-yl)ethylimino]-3,4,5,7-tetrahydroazocin-8-amine (PubChem CID 123991908) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 7-ethyl-2-imino-3-methyl-6-[2-(5-methylthiophen-2-yl)ethylimino]-3,4,5,7-tetrahydroazocin-8-amine.
| Compound Name | 7-ethyl-2-imino-3-methyl-6-[2-(5-methylthiophen-2-yl)ethylimino]-3,4,5,7-tetrahydroazocin-8-amine |
|---|---|
| PubChem CID | 123991908 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 7-ethyl-2-imino-3-methyl-6-[2-(5-methylthiophen-2-yl)ethylimino]-3,4,5,7-tetrahydroazocin-8-amine |
| SMILES | [H]/N=C1\N=C(\N)C(CC)/C(=N/CCc2ccc(C)s2)CCC1C |
| InChI | InChI=1S/C17H26N4S/c1-4-14-15(8-5-11(2)16(18)21-17(14)19)20-10-9-13-7-6-12(3)22-13/h6-7,11,14H,4-5,8-10H2,1-3H3,(H3,18,19,21)/b20-15+ |
| InChIKey | YFZIHQQVQBSNAZ-HMMYKYKNSA-N |
| XLogP | 3.83 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|