C23H23N5O — CID 123991959
2-[5-[6-(3,4-dihydro-2H-chromen-4-ylamino)-2-methylpyrimidin-4-yl]-2-methylanilino]acetonitrile (PubChem CID 123991959) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[5-[6-(3,4-dihydro-2H-chromen-4-ylamino)-2-methylpyrimidin-4-yl]-2-methylanilino]acetonitrile.
| Compound Name | 2-[5-[6-(3,4-dihydro-2H-chromen-4-ylamino)-2-methylpyrimidin-4-yl]-2-methylanilino]acetonitrile |
|---|---|
| PubChem CID | 123991959 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[5-[6-(3,4-dihydro-2H-chromen-4-ylamino)-2-methylpyrimidin-4-yl]-2-methylanilino]acetonitrile |
| SMILES | Cc1nc(NC2CCOc3ccccc32)cc(-c2ccc(C)c(NCC#N)c2)n1 |
| InChI | InChI=1S/C23H23N5O/c1-15-7-8-17(13-20(15)25-11-10-24)21-14-23(27-16(2)26-21)28-19-9-12-29-22-6-4-3-5-18(19)22/h3-8,13-14,19,25H,9,11-12H2,1-2H3,(H,26,27,28) |
| InChIKey | XYBRQTXFEMRMPS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|