About 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate
3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate (PubChem CID 123992182) has the molecular formula C16H32O3Si2
and a molecular weight of 328.60 g/mol. Its IUPAC name is 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate |
| PubChem CID | 123992182 |
| Molecular Formula | C16H32O3Si2 |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCC[SiH](C)C)C1([Si](C)(C)C)CCCCO1 |
| InChI | InChI=1S/C16H32O3Si2/c1-14(15(17)18-11-9-13-20(2)3)16(21(4,5)6)10-7-8-12-19-16/h20H,1,7-13H2,2-6H3 |
| InChIKey | SQQFUXULUANJEJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate?
The IUPAC name of 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate (CID 123992182) is 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate.
What is the SMILES notation for 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate?
The canonical SMILES for 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate is C=C(C(=O)OCCC[SiH](C)C)C1([Si](C)(C)C)CCCCO1.
What is the InChIKey of 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate?
The InChIKey is SQQFUXULUANJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3Si2/c1-14(15(17)18-11-9-13-20(2)3)16(21(4,5)6)10-7-8-12-19-16/h20H,1,7-13H2,2-6H3.
What are the key properties of 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate?
3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate has a molecular weight of 328.60 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethylsilylpropyl 2-(2-trimethylsilyloxan-2-yl)prop-2-enoate is sourced from PubChem (CID 123992182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).