C25H27F2N7O2 — CID 123992453
[4-(difluoromethoxy)anilino]-[[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]amino]methanol (PubChem CID 123992453) has the molecular formula C25H27F2N7O2 and a molecular weight of 495.53 g/mol. Its IUPAC name is [4-(difluoromethoxy)anilino]-[[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]amino]methanol.
| Compound Name | [4-(difluoromethoxy)anilino]-[[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]amino]methanol |
|---|---|
| PubChem CID | 123992453 |
| Molecular Formula | C25H27F2N7O2 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | [4-(difluoromethoxy)anilino]-[[1-[4-(2-methylpyrazol-3-yl)phthalazin-1-yl]piperidin-4-yl]amino]methanol |
| SMILES | Cn1nccc1-c1nnc(N2CCC(NC(O)Nc3ccc(OC(F)F)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C25H27F2N7O2/c1-33-21(10-13-28-33)22-19-4-2-3-5-20(19)23(32-31-22)34-14-11-17(12-15-34)30-25(35)29-16-6-8-18(9-7-16)36-24(26)27/h2-10,13,17,24-25,29-30,35H,11-12,14-15H2,1H3 |
| InChIKey | JEAKQPHAUJQBQU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|