About CID 123992515
CID 123992515 (PubChem CID 123992515) has the molecular formula C44H67N6O7Si6
and a molecular weight of 960.57 g/mol.
Molecular Properties
| Compound Name | CID 123992515 |
| PubChem CID | 123992515 |
| Molecular Formula | C44H67N6O7Si6 |
| Molecular Weight | 960.57 g/mol |
| Exact Mass | 959.37 |
| IUPAC Name | — |
| SMILES | Cc1cc(CCC[Si](C)(C)O[Si](C)(O)CC[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCc2cc(C)cc(-n3nc4ccccc4n3)c2O)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C44H67N6O7Si6/c1-33-29-35(43(51)41(31-33)49-45-37-21-13-14-22-38(37)46-49)19-17-26-59(4,5)55-62(10,11)57-61(8,9)54-58(3)25-28-63(12,53)56-60(6,7)27-18-20-36-30-34(2)32-42(44(36)52)50-47-39-23-15-16-24-40(39)48-50/h13-16,21-24,29-32,51-53H,17-20,25-28H2,1-12H3 |
| InChIKey | RCJHKWPPNJAUJU-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 960.57 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123992515 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123992515?
The IUPAC name of CID 123992515 (CID 123992515) is not available.
What is the SMILES notation for CID 123992515?
The canonical SMILES for CID 123992515 is Cc1cc(CCC[Si](C)(C)O[Si](C)(O)CC[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCc2cc(C)cc(-n3nc4ccccc4n3)c2O)c(O)c(-n2nc3ccccc3n2)c1.
What is the InChIKey of CID 123992515?
The InChIKey is RCJHKWPPNJAUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H67N6O7Si6/c1-33-29-35(43(51)41(31-33)49-45-37-21-13-14-22-38(37)46-49)19-17-26-59(4,5)55-62(10,11)57-61(8,9)54-58(3)25-28-63(12,53)56-60(6,7)27-18-20-36-30-34(2)32-42(44(36)52)50-47-39-23-15-16-24-40(39)48-50/h13-16,21-24,29-32,51-53H,17-20,25-28H2,1-12H3.
What are the key properties of CID 123992515?
CID 123992515 has a molecular weight of 960.57 g/mol, XLogP of 10.31, 21 rotatable bonds, 3 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123992515 is sourced from PubChem (CID 123992515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).