C33H38N6O3 — CID 123992534
4-[[4-[1-[6-[4-(2-amino-4-methoxyphenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethylideneamino]piperidin-1-yl]methyl]benzonitrile (PubChem CID 123992534) has the molecular formula C33H38N6O3 and a molecular weight of 566.71 g/mol. Its IUPAC name is 4-[[4-[1-[6-[4-(2-amino-4-methoxyphenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethylideneamino]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[1-[6-[4-(2-amino-4-methoxyphenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethylideneamino]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 123992534 |
| Molecular Formula | C33H38N6O3 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 4-[[4-[1-[6-[4-(2-amino-4-methoxyphenoxy)piperidine-1-carbonyl]-3-pyridinyl]ethylideneamino]piperidin-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(OC2CCN(C(=O)c3ccc(/C(C)=N/C4CCN(Cc5ccc(C#N)cc5)CC4)cn3)CC2)c(N)c1 |
| InChI | InChI=1S/C33H38N6O3/c1-23(37-27-11-15-38(16-12-27)22-25-5-3-24(20-34)4-6-25)26-7-9-31(36-21-26)33(40)39-17-13-28(14-18-39)42-32-10-8-29(41-2)19-30(32)35/h3-10,19,21,27-28H,11-18,22,35H2,1-2H3/b37-23+ |
| InChIKey | RYXZTMDJENOXMD-GUBAARJWSA-N |
| XLogP | 4.70 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|