C18H23BN4O2 — CID 123992583
2-cyclopropyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine (PubChem CID 123992583) has the molecular formula C18H23BN4O2 and a molecular weight of 338.22 g/mol. Its IUPAC name is 2-cyclopropyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 123992583 |
| Molecular Formula | C18H23BN4O2 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-cyclopropyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine |
| SMILES | CC1(C)OB(c2ccnc(Nc3ccnc(C4CC4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C18H23BN4O2/c1-17(2)18(3,4)25-19(24-17)13-7-9-20-15(11-13)22-14-8-10-21-16(23-14)12-5-6-12/h7-12H,5-6H2,1-4H3,(H,20,21,22,23) |
| InChIKey | FZRNONMOZONJQG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|