C18H24N8O2 — CID 123993113
5-[[[3-amino-6-[1-(2-hydroxyethylamino)-3-iminopropan-2-yl]-1,2-dihydropyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde (PubChem CID 123993113) has the molecular formula C18H24N8O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-[[[3-amino-6-[1-(2-hydroxyethylamino)-3-iminopropan-2-yl]-1,2-dihydropyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde.
| Compound Name | 5-[[[3-amino-6-[1-(2-hydroxyethylamino)-3-iminopropan-2-yl]-1,2-dihydropyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 123993113 |
| Molecular Formula | C18H24N8O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 5-[[[3-amino-6-[1-(2-hydroxyethylamino)-3-iminopropan-2-yl]-1,2-dihydropyrazin-2-yl]amino]methyl]pyrazolo[1,5-a]pyridine-3-carbaldehyde |
| SMILES | [H]/N=C/C(CNCCO)C1=CN=C(N)C(NCc2ccn3ncc(C=O)c3c2)N1 |
| InChI | InChI=1S/C18H24N8O2/c19-6-13(8-21-2-4-27)15-10-22-17(20)18(25-15)23-7-12-1-3-26-16(5-12)14(11-28)9-24-26/h1,3,5-6,9-11,13,18-19,21,23,25,27H,2,4,7-8H2,(H2,20,22)/b19-6+ |
| InChIKey | LGQJNCUFKFXCKV-KPSZGOFPSA-N |
| XLogP | -0.79 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|