C27H35ClF3N5O8S2 — CID 123993117
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[4-(tert-butylsulfonylamino)-3-methyl-4-oxobut-1-enyl]-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 123993117) has the molecular formula C27H35ClF3N5O8S2 and a molecular weight of 714.18 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[4-(tert-butylsulfonylamino)-3-methyl-4-oxobut-1-enyl]-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[4-(tert-butylsulfonylamino)-3-methyl-4-oxobut-1-enyl]-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 123993117 |
| Molecular Formula | C27H35ClF3N5O8S2 |
| Molecular Weight | 714.18 g/mol |
| Exact Mass | 713.16 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[2-[4-(tert-butylsulfonylamino)-3-methyl-4-oxobut-1-enyl]-4-(3-chloro-1-ethylpyrazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CCn1cc(S(=O)(=O)N2CC(C=CC(C)C(=O)NS(=O)(=O)C(C)(C)C)Oc3ccc(NC(=O)OC(C)(C)C(F)(F)F)cc32)c(Cl)n1 |
| InChI | InChI=1S/C27H35ClF3N5O8S2/c1-8-35-15-21(22(28)33-35)45(39,40)36-14-18(11-9-16(2)23(37)34-46(41,42)25(3,4)5)43-20-12-10-17(13-19(20)36)32-24(38)44-26(6,7)27(29,30)31/h9-13,15-16,18H,8,14H2,1-7H3,(H,32,38)(H,34,37) |
| InChIKey | HUUKKDQBCDVUEN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|