C13H17N3O3 — CID 123993399
N-[2-(2-hydroxyethoxy)ethyl]-2-methylimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 123993399) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-methylimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-methylimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 123993399 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-methylimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1cn2cc(C(=O)NCCOCCO)ccc2n1 |
| InChI | InChI=1S/C13H17N3O3/c1-10-8-16-9-11(2-3-12(16)15-10)13(18)14-4-6-19-7-5-17/h2-3,8-9,17H,4-7H2,1H3,(H,14,18) |
| InChIKey | OLIJMLBLLLWZPO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|