About N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide
N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide (PubChem CID 123993882) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide |
| PubChem CID | 123993882 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide |
| SMILES | COCCC(=O)NCC1=CCCC=C1 |
| InChI | InChI=1S/C11H17NO2/c1-14-8-7-11(13)12-9-10-5-3-2-4-6-10/h3,5-6H,2,4,7-9H2,1H3,(H,12,13) |
| InChIKey | HLLUPRKDRWIYTE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide (CID 123993882) is N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide is COCCC(=O)NCC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide?
The InChIKey is HLLUPRKDRWIYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-14-8-7-11(13)12-9-10-5-3-2-4-6-10/h3,5-6H,2,4,7-9H2,1H3,(H,12,13).
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide?
N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide has a molecular weight of 195.26 g/mol, XLogP of 1.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)-3-methoxypropanamide is sourced from PubChem (CID 123993882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).