C13H11FN2 — CID 123994846
4-(2-fluoro-5-methylphenyl)-5,6-dimethylidenepyrimidine (PubChem CID 123994846) has the molecular formula C13H11FN2 and a molecular weight of 214.24 g/mol. Its IUPAC name is 4-(2-fluoro-5-methylphenyl)-5,6-dimethylidenepyrimidine.
| Compound Name | 4-(2-fluoro-5-methylphenyl)-5,6-dimethylidenepyrimidine |
|---|---|
| PubChem CID | 123994846 |
| Molecular Formula | C13H11FN2 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-(2-fluoro-5-methylphenyl)-5,6-dimethylidenepyrimidine |
| SMILES | C=c1ncnc(-c2cc(C)ccc2F)c1=C |
| InChI | InChI=1S/C13H11FN2/c1-8-4-5-12(14)11(6-8)13-9(2)10(3)15-7-16-13/h4-7H,2-3H2,1H3 |
| InChIKey | MFLMBVSUIBRVGK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |