C16H20BF3N2O2 — CID 123995461
3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)indazole (PubChem CID 123995461) has the molecular formula C16H20BF3N2O2 and a molecular weight of 340.15 g/mol. Its IUPAC name is 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)indazole.
| Compound Name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)indazole |
|---|---|
| PubChem CID | 123995461 |
| Molecular Formula | C16H20BF3N2O2 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethyl)indazole |
| SMILES | Cc1c2cc(B3OC(C)(C)C(C)(C)O3)ccc2nn1CC(F)(F)F |
| InChI | InChI=1S/C16H20BF3N2O2/c1-10-12-8-11(17-23-14(2,3)15(4,5)24-17)6-7-13(12)21-22(10)9-16(18,19)20/h6-8H,9H2,1-5H3 |
| InChIKey | RDUHPOFHXZKJEB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|