About N-(4-hydroxybutyl)-N'-methylethanimidamide
N-(4-hydroxybutyl)-N'-methylethanimidamide (PubChem CID 123995490) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-(4-hydroxybutyl)-N'-methylethanimidamide |
| PubChem CID | 123995490 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-(4-hydroxybutyl)-N'-methylethanimidamide |
| SMILES | C/N=C(\C)NCCCCO |
| InChI | InChI=1S/C7H16N2O/c1-7(8-2)9-5-3-4-6-10/h10H,3-6H2,1-2H3,(H,8,9) |
| InChIKey | YNUUMPSEZOZBQE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxybutyl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxybutyl)-N'-methylethanimidamide?
The IUPAC name of N-(4-hydroxybutyl)-N'-methylethanimidamide (CID 123995490) is N-(4-hydroxybutyl)-N'-methylethanimidamide.
What is the SMILES notation for N-(4-hydroxybutyl)-N'-methylethanimidamide?
The canonical SMILES for N-(4-hydroxybutyl)-N'-methylethanimidamide is C/N=C(\C)NCCCCO.
What is the InChIKey of N-(4-hydroxybutyl)-N'-methylethanimidamide?
The InChIKey is YNUUMPSEZOZBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-7(8-2)9-5-3-4-6-10/h10H,3-6H2,1-2H3,(H,8,9).
What are the key properties of N-(4-hydroxybutyl)-N'-methylethanimidamide?
N-(4-hydroxybutyl)-N'-methylethanimidamide has a molecular weight of 144.22 g/mol, XLogP of 0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxybutyl)-N'-methylethanimidamide is sourced from PubChem (CID 123995490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).