C16H17ClN4O4S2 — CID 123995723
4a-[3-chloro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-amine (PubChem CID 123995723) has the molecular formula C16H17ClN4O4S2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 4a-[3-chloro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-amine.
| Compound Name | 4a-[3-chloro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 123995723 |
| Molecular Formula | C16H17ClN4O4S2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 4a-[3-chloro-5-(5-methoxy-3-pyridinyl)thiophen-2-yl]-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-amine |
| SMILES | COc1cncc(-c2cc(Cl)c(C34COCC3S(=O)(=O)N(C)C(N)=N4)s2)c1 |
| InChI | InChI=1S/C16H17ClN4O4S2/c1-21-15(18)20-16(8-25-7-13(16)27(21,22)23)14-11(17)4-12(26-14)9-3-10(24-2)6-19-5-9/h3-6,13H,7-8H2,1-2H3,(H2,18,20) |
| InChIKey | CMOSGQBJTYIOGF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |