About 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine
3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine (PubChem CID 123995864) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine.
Molecular Properties
| Compound Name | 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine |
| PubChem CID | 123995864 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine |
| SMILES | CC1C=NC=C/C(=N\C2CCN(C)CC2)C1C |
| InChI | InChI=1S/C14H23N3/c1-11-10-15-7-4-14(12(11)2)16-13-5-8-17(3)9-6-13/h4,7,10-13H,5-6,8-9H2,1-3H3/b16-14+ |
| InChIKey | CBGRVHUDKGCASY-JQIJEIRASA-N |
| XLogP | 2.39 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine?
The IUPAC name of 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine (CID 123995864) is 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine.
What is the SMILES notation for 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine?
The canonical SMILES for 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine is CC1C=NC=C/C(=N\C2CCN(C)CC2)C1C.
What is the InChIKey of 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine?
The InChIKey is CBGRVHUDKGCASY-JQIJEIRASA-N. The full InChI is InChI=1S/C14H23N3/c1-11-10-15-7-4-14(12(11)2)16-13-5-8-17(3)9-6-13/h4,7,10-13H,5-6,8-9H2,1-3H3/b16-14+.
What are the key properties of 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine?
3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine has a molecular weight of 233.36 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-N-(1-methylpiperidin-4-yl)-3,4-dihydroazepin-5-imine is sourced from PubChem (CID 123995864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).