C21H22O4S — CID 123996204
S-[(1R,2R,6S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] ethanethioate (PubChem CID 123996204) has the molecular formula C21H22O4S and a molecular weight of 370.47 g/mol. Its IUPAC name is S-[(1R,2R,6S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] ethanethioate.
| Compound Name | S-[(1R,2R,6S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] ethanethioate |
|---|---|
| PubChem CID | 123996204 |
| Molecular Formula | C21H22O4S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | S-[(1R,2R,6S,7S)-7-methyl-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-8-en-8-yl] ethanethioate |
| SMILES | CC(=O)SC1=C[C@@H]2O[C@@]1(C)[C@H]1C(=O)C(c3c(C)cc(C)cc3C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C21H22O4S/c1-9-6-10(2)15(11(3)7-9)17-19(23)16-13-8-14(26-12(4)22)21(5,25-13)18(16)20(17)24/h6-8,13,16-18H,1-5H3/t13-,16-,17?,18+,21+/m0/s1 |
| InChIKey | BESSPRDNABXNMH-WEBLSCSRSA-N |
| XLogP | 3.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|