C14H27FN2 — CID 123996535
(Z)-9-fluoro-4-imino-9,10,10-trimethylundec-5-en-3-amine (PubChem CID 123996535) has the molecular formula C14H27FN2 and a molecular weight of 242.38 g/mol. Its IUPAC name is (Z)-9-fluoro-4-imino-9,10,10-trimethylundec-5-en-3-amine.
| Compound Name | (Z)-9-fluoro-4-imino-9,10,10-trimethylundec-5-en-3-amine |
|---|---|
| PubChem CID | 123996535 |
| Molecular Formula | C14H27FN2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (Z)-9-fluoro-4-imino-9,10,10-trimethylundec-5-en-3-amine |
| SMILES | [H]/N=C(/C=C\CCC(C)(F)C(C)(C)C)C(N)CC |
| InChI | InChI=1S/C14H27FN2/c1-6-11(16)12(17)9-7-8-10-14(5,15)13(2,3)4/h7,9,11,17H,6,8,10,16H2,1-5H3/b9-7-,17-12- |
| InChIKey | ODXIHAMXRKCSEV-JKFBDIMUSA-N |
| XLogP | 3.85 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|