C16H33N3O3Si — CID 123997089
N-[methyl-bis[(pent-2-en-3-ylamino)oxy]silyl]oxypent-2-en-3-amine (PubChem CID 123997089) has the molecular formula C16H33N3O3Si and a molecular weight of 343.54 g/mol. Its IUPAC name is N-[methyl-bis[(pent-2-en-3-ylamino)oxy]silyl]oxypent-2-en-3-amine.
| Compound Name | N-[methyl-bis[(pent-2-en-3-ylamino)oxy]silyl]oxypent-2-en-3-amine |
|---|---|
| PubChem CID | 123997089 |
| Molecular Formula | C16H33N3O3Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[methyl-bis[(pent-2-en-3-ylamino)oxy]silyl]oxypent-2-en-3-amine |
| SMILES | CC=C(CC)NO[Si](C)(ONC(=CC)CC)ONC(=CC)CC |
| InChI | InChI=1S/C16H33N3O3Si/c1-8-14(9-2)17-20-23(7,21-18-15(10-3)11-4)22-19-16(12-5)13-6/h8,10,12,17-19H,9,11,13H2,1-7H3 |
| InChIKey | YCDUVVPXYZUMLH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|