C20H24N2O — CID 123997250
4-(5-cyanopent-1-ynyl)-N-cyclobutyl-7-ethylcyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 123997250) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-(5-cyanopent-1-ynyl)-N-cyclobutyl-7-ethylcyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | 4-(5-cyanopent-1-ynyl)-N-cyclobutyl-7-ethylcyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 123997250 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 4-(5-cyanopent-1-ynyl)-N-cyclobutyl-7-ethylcyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | CCC1C=CC(C#CCCCC#N)=CC=C1C(=O)NC1CCC1 |
| InChI | InChI=1S/C20H24N2O/c1-2-17-13-11-16(8-5-3-4-6-15-21)12-14-19(17)20(23)22-18-9-7-10-18/h11-14,17-18H,2-4,6-7,9-10H2,1H3,(H,22,23) |
| InChIKey | FBZNQGOHGONIJR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|